C12H14O5 — CID 162945043
[(2S)-2,3-dihydroxypropyl] 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162945043) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is [(2S)-2,3-dihydroxypropyl] 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-2,3-dihydroxypropyl] 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162945043 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [(2S)-2,3-dihydroxypropyl] 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)cc1)OC[C@@H](O)CO |
| InChI | InChI=1S/C12H14O5/c13-7-11(15)8-17-12(16)6-3-9-1-4-10(14)5-2-9/h1-6,11,13-15H,7-8H2/t11-/m0/s1 |
| InChIKey | YUQSZTOOHLGKGG-NSHDSACASA-N |
| XLogP | 0.30 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|