C23H22O9 — CID 71439405
[2-acetyloxy-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propyl] 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 71439405) has the molecular formula C23H22O9 and a molecular weight of 442.42 g/mol. Its IUPAC name is [2-acetyloxy-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propyl] 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [2-acetyloxy-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propyl] 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71439405 |
| Molecular Formula | C23H22O9 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | [2-acetyloxy-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propyl] 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | CC(=O)OC(COC(=O)C=Cc1ccc(O)cc1)COC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C23H22O9/c1-15(24)32-19(13-30-22(28)10-5-16-2-7-18(25)8-3-16)14-31-23(29)11-6-17-4-9-20(26)21(27)12-17/h2-12,19,25-27H,13-14H2,1H3 |
| InChIKey | GLVFLAONFKWEJN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|