C22H22O8 — CID 58223730
[1-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-hydroxypropan-2-yl] (E)-3-(4-hydroxy-3-methylphenyl)prop-2-enoate (PubChem CID 58223730) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is [1-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-hydroxypropan-2-yl] (E)-3-(4-hydroxy-3-methylphenyl)prop-2-enoate.
| Compound Name | [1-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-hydroxypropan-2-yl] (E)-3-(4-hydroxy-3-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58223730 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | [1-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-hydroxypropan-2-yl] (E)-3-(4-hydroxy-3-methylphenyl)prop-2-enoate |
| SMILES | Cc1cc(/C=C/C(=O)OC(CO)COC(=O)/C=C/c2ccc(O)c(O)c2)ccc1O |
| InChI | InChI=1S/C22H22O8/c1-14-10-15(2-6-18(14)24)5-9-22(28)30-17(12-23)13-29-21(27)8-4-16-3-7-19(25)20(26)11-16/h2-11,17,23-26H,12-13H2,1H3/b8-4+,9-5+ |
| InChIKey | DEVGHPLSHDBEGR-KBXRYBNXSA-N |
| XLogP | 2.29 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|