C21H20O9 — CID 76707767
[2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxypropyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 76707767) has the molecular formula C21H20O9 and a molecular weight of 416.38 g/mol. Its IUPAC name is [2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxypropyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxypropyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 76707767 |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-3-hydroxypropyl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OCC(CO)OC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H20O9/c22-11-15(30-21(28)8-4-14-2-6-17(24)19(26)10-14)12-29-20(27)7-3-13-1-5-16(23)18(25)9-13/h1-10,15,22-26H,11-12H2 |
| InChIKey | HCUYWGOKHCCCTA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|