C33H30O15 — CID 89200574
4,5,6-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2-hydroxyhexanoic acid (PubChem CID 89200574) has the molecular formula C33H30O15 and a molecular weight of 666.59 g/mol. Its IUPAC name is 4,5,6-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2-hydroxyhexanoic acid.
| Compound Name | 4,5,6-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 89200574 |
| Molecular Formula | C33H30O15 |
| Molecular Weight | 666.59 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | 4,5,6-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2-hydroxyhexanoic acid |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OCC(OC(=O)/C=C/c1ccc(O)c(O)c1)C(CC(O)C(=O)O)OC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C33H30O15/c34-21-7-1-18(13-24(21)37)4-10-30(41)46-17-29(48-32(43)12-6-20-3-9-23(36)26(39)15-20)28(16-27(40)33(44)45)47-31(42)11-5-19-2-8-22(35)25(38)14-19/h1-15,27-29,34-40H,16-17H2,(H,44,45)/b10-4+,11-5+,12-6+ |
| InChIKey | NWLVRJMVCGISDS-ZDLWVMOESA-N |
| XLogP | 2.56 |
| TPSA | 257.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|