C13H12O9 — CID 172807489
4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 172807489) has the molecular formula C13H12O9 and a molecular weight of 312.23 g/mol. Its IUPAC name is 4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | 4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 172807489 |
| Molecular Formula | C13H12O9 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC(=O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C13H12O9/c14-7-3-1-6(5-8(7)15)2-4-9(16)22-13(21)11(18)10(17)12(19)20/h1-5,10-11,14-15,17-18H,(H,19,20)/b4-2+ |
| InChIKey | RSDXHJOMGQKHHT-DUXPYHPUSA-N |
| XLogP | -1.01 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|