C26H24O14 — CID 16735596
(Z)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2,6-dihydroxy-7-methoxy-7-oxohept-5-enoic acid (PubChem CID 16735596) has the molecular formula C26H24O14 and a molecular weight of 560.46 g/mol. Its IUPAC name is (Z)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2,6-dihydroxy-7-methoxy-7-oxohept-5-enoic acid.
| Compound Name | (Z)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2,6-dihydroxy-7-methoxy-7-oxohept-5-enoic acid |
|---|---|
| PubChem CID | 16735596 |
| Molecular Formula | C26H24O14 |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | (Z)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2,6-dihydroxy-7-methoxy-7-oxohept-5-enoic acid |
| SMILES | COC(=O)/C(O)=C/C(OC(=O)/C=C/c1ccc(O)c(O)c1)C(OC(=O)/C=C/c1ccc(O)c(O)c1)C(O)C(=O)O |
| InChI | InChI=1S/C26H24O14/c1-38-26(37)19(31)12-20(39-21(32)8-4-13-2-6-15(27)17(29)10-13)24(23(34)25(35)36)40-22(33)9-5-14-3-7-16(28)18(30)11-14/h2-12,20,23-24,27-31,34H,1H3,(H,35,36)/b8-4+,9-5+,19-12- |
| InChIKey | VVCGWWNFYSGJNK-FXXPWKTBSA-N |
| XLogP | 1.12 |
| TPSA | 237.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|