C21H22O7 — CID 177249030
methyl 3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-(4-hydroxyphenyl)-2,2-dimethylpropanoate (PubChem CID 177249030) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is methyl 3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-(4-hydroxyphenyl)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-(4-hydroxyphenyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 177249030 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | methyl 3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-(4-hydroxyphenyl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)C(OC(=O)/C=C/c1ccc(O)c(O)c1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H22O7/c1-21(2,20(26)27-3)19(14-6-8-15(22)9-7-14)28-18(25)11-5-13-4-10-16(23)17(24)12-13/h4-12,19,22-24H,1-3H3/b11-5+ |
| InChIKey | HTYYUMPQDNRNMM-VZUCSPMQSA-N |
| XLogP | 3.30 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|