C18H16O8 — CID 163185213
(3R)-3-(3,4-dihydroxyphenyl)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid (PubChem CID 163185213) has the molecular formula C18H16O8 and a molecular weight of 360.32 g/mol. Its IUPAC name is (3R)-3-(3,4-dihydroxyphenyl)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid.
| Compound Name | (3R)-3-(3,4-dihydroxyphenyl)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 163185213 |
| Molecular Formula | C18H16O8 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (3R)-3-(3,4-dihydroxyphenyl)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxypropanoic acid |
| SMILES | O=C(O)C[C@@H](OC(=O)/C=C/c1ccc(O)c(O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H16O8/c19-12-4-1-10(7-14(12)21)2-6-18(25)26-16(9-17(23)24)11-3-5-13(20)15(22)8-11/h1-8,16,19-22H,9H2,(H,23,24)/b6-2+/t16-/m1/s1 |
| InChIKey | GAQXTAWZNDSRDE-BAXHPOPBSA-N |
| XLogP | 2.28 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|