C20H20O8 — CID 162890361
ethyl 3-(3,4-dihydroxyphenyl)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoate (PubChem CID 162890361) has the molecular formula C20H20O8 and a molecular weight of 388.37 g/mol. Its IUPAC name is ethyl 3-(3,4-dihydroxyphenyl)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoate.
| Compound Name | ethyl 3-(3,4-dihydroxyphenyl)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoate |
|---|---|
| PubChem CID | 162890361 |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl 3-(3,4-dihydroxyphenyl)-3-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]propanoate |
| SMILES | CCOC(=O)CC(OC(=O)C=Cc1ccc(O)c(O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H20O8/c1-2-27-20(26)11-18(13-5-7-15(22)17(24)10-13)28-19(25)8-4-12-3-6-14(21)16(23)9-12/h3-10,18,21-24H,2,11H2,1H3 |
| InChIKey | HGNBCZFZBKBJMT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|