C33H28O17 — CID 101227453
(2S,3R,4S,5S)-2,3,5-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-4-hydroxyhexanedioic acid (PubChem CID 101227453) has the molecular formula C33H28O17 and a molecular weight of 696.57 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2,3,5-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-4-hydroxyhexanedioic acid.
| Compound Name | (2S,3R,4S,5S)-2,3,5-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-4-hydroxyhexanedioic acid |
|---|---|
| PubChem CID | 101227453 |
| Molecular Formula | C33H28O17 |
| Molecular Weight | 696.57 g/mol |
| Exact Mass | 696.13 |
| IUPAC Name | (2S,3R,4S,5S)-2,3,5-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-4-hydroxyhexanedioic acid |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]([C@H](O)[C@H](OC(=O)/C=C/c1ccc(O)c(O)c1)C(=O)O)[C@H](OC(=O)/C=C/c1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C33H28O17/c34-19-7-1-16(13-22(19)37)4-10-25(40)48-29(31(33(46)47)50-27(42)12-6-18-3-9-21(36)24(39)15-18)28(43)30(32(44)45)49-26(41)11-5-17-2-8-20(35)23(38)14-17/h1-15,28-31,34-39,43H,(H,44,45)(H,46,47)/b10-4+,11-5+,12-6+/t28-,29+,30-,31-/m0/s1 |
| InChIKey | SLEBIJYTAGSEKM-GBALHERYSA-N |
| XLogP | 1.63 |
| TPSA | 295.11 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.57 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|