C27H26O14 — CID 162951795
dimethyl (4S,5S,6R)-4,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-2,6-dihydroxyhept-2-enedioate (PubChem CID 162951795) has the molecular formula C27H26O14 and a molecular weight of 574.49 g/mol. Its IUPAC name is dimethyl (4S,5S,6R)-4,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-2,6-dihydroxyhept-2-enedioate.
| Compound Name | dimethyl (4S,5S,6R)-4,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-2,6-dihydroxyhept-2-enedioate |
|---|---|
| PubChem CID | 162951795 |
| Molecular Formula | C27H26O14 |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | dimethyl (4S,5S,6R)-4,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-2,6-dihydroxyhept-2-enedioate |
| SMILES | COC(=O)C(O)=C[C@H](OC(=O)C=Cc1ccc(O)c(O)c1)[C@@H](OC(=O)C=Cc1ccc(O)c(O)c1)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C27H26O14/c1-38-26(36)20(32)13-21(40-22(33)9-5-14-3-7-16(28)18(30)11-14)25(24(35)27(37)39-2)41-23(34)10-6-15-4-8-17(29)19(31)12-15/h3-13,21,24-25,28-32,35H,1-2H3/t21-,24+,25+/m0/s1 |
| InChIKey | FYYVQYOQVYGMAV-FTBPSBKWSA-N |
| XLogP | 1.21 |
| TPSA | 226.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|