C13H12O7 — CID 161032725
2,3-dihydroxy-4-oxo-4-(3-phenylprop-2-enoyloxy)butanoic acid (PubChem CID 161032725) has the molecular formula C13H12O7 and a molecular weight of 280.23 g/mol. Its IUPAC name is 2,3-dihydroxy-4-oxo-4-(3-phenylprop-2-enoyloxy)butanoic acid.
| Compound Name | 2,3-dihydroxy-4-oxo-4-(3-phenylprop-2-enoyloxy)butanoic acid |
|---|---|
| PubChem CID | 161032725 |
| Molecular Formula | C13H12O7 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2,3-dihydroxy-4-oxo-4-(3-phenylprop-2-enoyloxy)butanoic acid |
| SMILES | O=C(C=Cc1ccccc1)OC(=O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C13H12O7/c14-9(7-6-8-4-2-1-3-5-8)20-13(19)11(16)10(15)12(17)18/h1-7,10-11,15-16H,(H,17,18) |
| InChIKey | TZVJDGLANJWRBG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|