C36H46O2 — CID 118545521
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-[(E)-4,8-dimethylnon-3-enyl]anthracene-9,10-dione (PubChem CID 118545521) has the molecular formula C36H46O2 and a molecular weight of 510.76 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-[(E)-4,8-dimethylnon-3-enyl]anthracene-9,10-dione.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-[(E)-4,8-dimethylnon-3-enyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 118545521 |
| Molecular Formula | C36H46O2 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-[(E)-4,8-dimethylnon-3-enyl]anthracene-9,10-dione |
| SMILES | CC(C)=CCC/C(C)=C/CCc1ccc2c(c1)C(=O)c1ccc(CC/C=C(\C)CCCC(C)C)cc1C2=O |
| InChI | InChI=1S/C36H46O2/c1-25(2)11-7-13-27(5)15-9-17-29-19-21-31-33(23-29)35(37)32-22-20-30(24-34(32)36(31)38)18-10-16-28(6)14-8-12-26(3)4/h11,15-16,19-24,26H,7-10,12-14,17-18H2,1-6H3/b27-15+,28-16+ |
| InChIKey | OEOKTVZPJPRBGW-DPCVLPDWSA-N |
| XLogP | 9.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|