C31H38O2 — CID 118545562
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-7-(4-methylpentyl)anthracene-9,10-dione (PubChem CID 118545562) has the molecular formula C31H38O2 and a molecular weight of 442.64 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-7-(4-methylpentyl)anthracene-9,10-dione.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-7-(4-methylpentyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 118545562 |
| Molecular Formula | C31H38O2 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-7-(4-methylpentyl)anthracene-9,10-dione |
| SMILES | CC(C)=CCC/C(C)=C/CCc1ccc2c(c1)C(=O)c1cc(CCCC(C)C)ccc1C2=O |
| InChI | InChI=1S/C31H38O2/c1-21(2)9-6-11-23(5)12-8-14-25-16-18-27-29(20-25)31(33)28-19-24(13-7-10-22(3)4)15-17-26(28)30(27)32/h9,12,15-20,22H,6-8,10-11,13-14H2,1-5H3/b23-12+ |
| InChIKey | RGKBJDFLHIGABW-FSJBWODESA-N |
| XLogP | 8.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|