About [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate
[6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate (PubChem CID 11808737) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate.
Molecular Properties
| Compound Name | [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate |
| PubChem CID | 11808737 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate |
| SMILES | CC(=O)OC1=CC(=O)c2cc(CCCC(C)C)ccc2C1=O |
| InChI | InChI=1S/C18H20O4/c1-11(2)5-4-6-13-7-8-14-15(9-13)16(20)10-17(18(14)21)22-12(3)19/h7-11H,4-6H2,1-3H3 |
| InChIKey | CRAAVJXLZKOEHB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate?
The IUPAC name of [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate (CID 11808737) is [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate.
What is the SMILES notation for [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate?
The canonical SMILES for [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate is CC(=O)OC1=CC(=O)c2cc(CCCC(C)C)ccc2C1=O.
What is the InChIKey of [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate?
The InChIKey is CRAAVJXLZKOEHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O4/c1-11(2)5-4-6-13-7-8-14-15(9-13)16(20)10-17(18(14)21)22-12(3)19/h7-11H,4-6H2,1-3H3.
What are the key properties of [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate?
[6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate has a molecular weight of 300.35 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-methylpentyl)-1,4-dioxonaphthalen-2-yl] acetate is sourced from PubChem (CID 11808737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).