C20H30O5 — CID 163107949
(2R,6E,10E)-13-(2-hydroxy-5-oxo-2H-furan-4-yl)-2,6,10-trimethyltrideca-6,10-dienoic acid (PubChem CID 163107949) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2R,6E,10E)-13-(2-hydroxy-5-oxo-2H-furan-4-yl)-2,6,10-trimethyltrideca-6,10-dienoic acid.
| Compound Name | (2R,6E,10E)-13-(2-hydroxy-5-oxo-2H-furan-4-yl)-2,6,10-trimethyltrideca-6,10-dienoic acid |
|---|---|
| PubChem CID | 163107949 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (2R,6E,10E)-13-(2-hydroxy-5-oxo-2H-furan-4-yl)-2,6,10-trimethyltrideca-6,10-dienoic acid |
| SMILES | C/C(=C\CCC1=CC(O)OC1=O)CC/C=C(\C)CCC[C@@H](C)C(=O)O |
| InChI | InChI=1S/C20H30O5/c1-14(9-5-11-16(3)19(22)23)7-4-8-15(2)10-6-12-17-13-18(21)25-20(17)24/h7,10,13,16,18,21H,4-6,8-9,11-12H2,1-3H3,(H,22,23)/b14-7+,15-10+/t16-,18?/m1/s1 |
| InChIKey | CPMWPGTWVFIEII-MDSJIKRISA-N |
| XLogP | 4.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|