C29H52O4 — CID 129151583
(E)-6-hydroxy-16-(3-hydroxy-4,5,6-trimethylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadec-9-enoic acid (PubChem CID 129151583) has the molecular formula C29H52O4 and a molecular weight of 464.73 g/mol. Its IUPAC name is (E)-6-hydroxy-16-(3-hydroxy-4,5,6-trimethylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadec-9-enoic acid.
| Compound Name | (E)-6-hydroxy-16-(3-hydroxy-4,5,6-trimethylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadec-9-enoic acid |
|---|---|
| PubChem CID | 129151583 |
| Molecular Formula | C29H52O4 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.39 |
| IUPAC Name | (E)-6-hydroxy-16-(3-hydroxy-4,5,6-trimethylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadec-9-enoic acid |
| SMILES | C/C(=C\CCC(C)(O)CCCC(C)C(=O)O)CCCC(C)CCC1=CC(O)C(C)C(C)C1C |
| InChI | InChI=1S/C29H52O4/c1-20(13-9-17-29(7,33)18-10-14-22(3)28(31)32)11-8-12-21(2)15-16-26-19-27(30)25(6)23(4)24(26)5/h13,19,21-25,27,30,33H,8-12,14-18H2,1-7H3,(H,31,32)/b20-13+ |
| InChIKey | ZUYCYHZOIFNVON-DEDYPNTBSA-N |
| XLogP | 7.15 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|