C33H60O4 — CID 122634722
(E)-17-(6-butoxy-3-hydroxy-4,5-dimethylcyclohexen-1-yl)-7-hydroxy-3,7,11,15-tetramethylheptadec-10-en-2-one (PubChem CID 122634722) has the molecular formula C33H60O4 and a molecular weight of 520.84 g/mol. Its IUPAC name is (E)-17-(6-butoxy-3-hydroxy-4,5-dimethylcyclohexen-1-yl)-7-hydroxy-3,7,11,15-tetramethylheptadec-10-en-2-one.
| Compound Name | (E)-17-(6-butoxy-3-hydroxy-4,5-dimethylcyclohexen-1-yl)-7-hydroxy-3,7,11,15-tetramethylheptadec-10-en-2-one |
|---|---|
| PubChem CID | 122634722 |
| Molecular Formula | C33H60O4 |
| Molecular Weight | 520.84 g/mol |
| Exact Mass | 520.45 |
| IUPAC Name | (E)-17-(6-butoxy-3-hydroxy-4,5-dimethylcyclohexen-1-yl)-7-hydroxy-3,7,11,15-tetramethylheptadec-10-en-2-one |
| SMILES | CCCCOC1C(CCC(C)CCC/C(C)=C/CCC(C)(O)CCCC(C)C(C)=O)=CC(O)C(C)C1C |
| InChI | InChI=1S/C33H60O4/c1-9-10-22-37-32-28(6)27(5)31(35)23-30(32)19-18-25(3)15-11-14-24(2)16-12-20-33(8,36)21-13-17-26(4)29(7)34/h16,23,25-28,31-32,35-36H,9-15,17-22H2,1-8H3/b24-16+ |
| InChIKey | ODNQQXLTZDDJII-LFVJCYFKSA-N |
| XLogP | 8.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.84 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|