C32H55O4- — CID 59271489
(E)-16-(6-butoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-6-hydroxy-2,6,10,14-tetramethylhexadec-10-enoate (PubChem CID 59271489) has the molecular formula C32H55O4- and a molecular weight of 503.79 g/mol. Its IUPAC name is (E)-16-(6-butoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-6-hydroxy-2,6,10,14-tetramethylhexadec-10-enoate.
| Compound Name | (E)-16-(6-butoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-6-hydroxy-2,6,10,14-tetramethylhexadec-10-enoate |
|---|---|
| PubChem CID | 59271489 |
| Molecular Formula | C32H55O4- |
| Molecular Weight | 503.79 g/mol |
| Exact Mass | 503.41 |
| IUPAC Name | (E)-16-(6-butoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-6-hydroxy-2,6,10,14-tetramethylhexadec-10-enoate |
| SMILES | CCCCOC1C(CCC(C)CC/C=C(\C)CCCC(C)(O)CCCC(C)C(=O)[O-])=CC=C(C)C1C |
| InChI | InChI=1S/C32H56O4/c1-8-9-23-36-30-28(6)26(4)18-20-29(30)19-17-25(3)14-10-13-24(2)15-11-21-32(7,35)22-12-16-27(5)31(33)34/h13,18,20,25,27-28,30,35H,8-12,14-17,19,21-23H2,1-7H3,(H,33,34)/p-1/b24-13+ |
| InChIKey | PLPCTZMNGMGLID-ZMOGYAJESA-M |
| XLogP | 7.31 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.79 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|