C27H52O — CID 159115115
1-(3,7-dimethyloctyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene;methane (PubChem CID 159115115) has the molecular formula C27H52O and a molecular weight of 392.71 g/mol. Its IUPAC name is 1-(3,7-dimethyloctyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene;methane.
| Compound Name | 1-(3,7-dimethyloctyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene;methane |
|---|---|
| PubChem CID | 159115115 |
| Molecular Formula | C27H52O |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 392.40 |
| IUPAC Name | 1-(3,7-dimethyloctyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene;methane |
| SMILES | C.CCCCCCCCOC1C(CCC(C)CCCC(C)C)=CC=C(C)C1C |
| InChI | InChI=1S/C26H48O.CH4/c1-7-8-9-10-11-12-20-27-26-24(6)23(5)17-19-25(26)18-16-22(4)15-13-14-21(2)3;/h17,19,21-22,24,26H,7-16,18,20H2,1-6H3;1H4 |
| InChIKey | KEZGNSNZQUYZEF-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|