C34H58O3 — CID 59271286
(5E,9E)-16-(6-hexoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadeca-5,9-dienoic acid (PubChem CID 59271286) has the molecular formula C34H58O3 and a molecular weight of 514.84 g/mol. Its IUPAC name is (5E,9E)-16-(6-hexoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadeca-5,9-dienoic acid.
| Compound Name | (5E,9E)-16-(6-hexoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadeca-5,9-dienoic acid |
|---|---|
| PubChem CID | 59271286 |
| Molecular Formula | C34H58O3 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.44 |
| IUPAC Name | (5E,9E)-16-(6-hexoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadeca-5,9-dienoic acid |
| SMILES | CCCCCCOC1C(CCC(C)CCC/C(C)=C/CC/C(C)=C/CCC(C)C(=O)O)=CC=C(C)C1C |
| InChI | InChI=1S/C34H58O3/c1-8-9-10-11-25-37-33-31(7)29(5)22-24-32(33)23-21-28(4)18-13-17-26(2)15-12-16-27(3)19-14-20-30(6)34(35)36/h15,19,22,24,28,30-31,33H,8-14,16-18,20-21,23,25H2,1-7H3,(H,35,36)/b26-15+,27-19+ |
| InChIKey | SQVQGXXEVPEEAN-XKJBPUOOSA-N |
| XLogP | 10.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|