C28H49O3P — CID 129151560
(5E,9E)-16-(3-hydroxy-4,5-dimethyl-6-phosphanylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadeca-5,9-dienoic acid (PubChem CID 129151560) has the molecular formula C28H49O3P and a molecular weight of 464.67 g/mol. Its IUPAC name is (5E,9E)-16-(3-hydroxy-4,5-dimethyl-6-phosphanylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadeca-5,9-dienoic acid.
| Compound Name | (5E,9E)-16-(3-hydroxy-4,5-dimethyl-6-phosphanylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadeca-5,9-dienoic acid |
|---|---|
| PubChem CID | 129151560 |
| Molecular Formula | C28H49O3P |
| Molecular Weight | 464.67 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | (5E,9E)-16-(3-hydroxy-4,5-dimethyl-6-phosphanylcyclohexen-1-yl)-2,6,10,14-tetramethylhexadeca-5,9-dienoic acid |
| SMILES | C/C(=C\CCC(C)C(=O)O)CC/C=C(\C)CCCC(C)CCC1=CC(O)C(C)C(C)C1P |
| InChI | InChI=1S/C28H49O3P/c1-19(10-7-11-20(2)14-9-15-22(4)28(30)31)12-8-13-21(3)16-17-25-18-26(29)23(5)24(6)27(25)32/h10,14,18,21-24,26-27,29H,7-9,11-13,15-17,32H2,1-6H3,(H,30,31)/b19-10+,20-14+ |
| InChIKey | IRRKREJWUPACMG-GNUCVDFRSA-N |
| XLogP | 7.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.67 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|