C27H51O2P — CID 129151585
3-[(E)-7-hydroxy-3,7,11-trimethylhexadec-11-enyl]-5,6-dimethyl-4-phosphanylcyclohex-2-en-1-ol (PubChem CID 129151585) has the molecular formula C27H51O2P and a molecular weight of 438.68 g/mol. Its IUPAC name is 3-[(E)-7-hydroxy-3,7,11-trimethylhexadec-11-enyl]-5,6-dimethyl-4-phosphanylcyclohex-2-en-1-ol.
| Compound Name | 3-[(E)-7-hydroxy-3,7,11-trimethylhexadec-11-enyl]-5,6-dimethyl-4-phosphanylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 129151585 |
| Molecular Formula | C27H51O2P |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.36 |
| IUPAC Name | 3-[(E)-7-hydroxy-3,7,11-trimethylhexadec-11-enyl]-5,6-dimethyl-4-phosphanylcyclohex-2-en-1-ol |
| SMILES | CCCC/C=C(\C)CCCC(C)(O)CCCC(C)CCC1=CC(O)C(C)C(C)C1P |
| InChI | InChI=1S/C27H51O2P/c1-7-8-9-12-20(2)13-10-17-27(6,29)18-11-14-21(3)15-16-24-19-25(28)22(4)23(5)26(24)30/h12,19,21-23,25-26,28-29H,7-11,13-18,30H2,1-6H3/b20-12+ |
| InChIKey | YQXZBYUPGLNNQO-UDWIEESQSA-N |
| XLogP | 7.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|