C28H47O4- — CID 59271542
(E)-6-hydroxy-16-(3-hydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)-2,6,10,14-tetramethylhexadec-9-enoate (PubChem CID 59271542) has the molecular formula C28H47O4- and a molecular weight of 447.68 g/mol. Its IUPAC name is (E)-6-hydroxy-16-(3-hydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)-2,6,10,14-tetramethylhexadec-9-enoate.
| Compound Name | (E)-6-hydroxy-16-(3-hydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)-2,6,10,14-tetramethylhexadec-9-enoate |
|---|---|
| PubChem CID | 59271542 |
| Molecular Formula | C28H47O4- |
| Molecular Weight | 447.68 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | (E)-6-hydroxy-16-(3-hydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)-2,6,10,14-tetramethylhexadec-9-enoate |
| SMILES | CC1=C(C)C(O)C=C(CCC(C)CCC/C(C)=C/CCC(C)(O)CCCC(C)C(=O)[O-])C1 |
| InChI | InChI=1S/C28H48O4/c1-20(12-8-16-28(6,32)17-9-13-22(3)27(30)31)10-7-11-21(2)14-15-25-18-23(4)24(5)26(29)19-25/h12,19,21-22,26,29,32H,7-11,13-18H2,1-6H3,(H,30,31)/p-1/b20-12+ |
| InChIKey | ZRYPZRPQKNBGNY-UDWIEESQSA-M |
| XLogP | 5.63 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|