C29H49O6- — CID 163896423
(E)-6,10-dihydroxy-16-(3-hydroxy-6-methoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-2,6,10,14-tetramethylhexadec-2-enoate (PubChem CID 163896423) has the molecular formula C29H49O6- and a molecular weight of 493.71 g/mol. Its IUPAC name is (E)-6,10-dihydroxy-16-(3-hydroxy-6-methoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-2,6,10,14-tetramethylhexadec-2-enoate.
| Compound Name | (E)-6,10-dihydroxy-16-(3-hydroxy-6-methoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-2,6,10,14-tetramethylhexadec-2-enoate |
|---|---|
| PubChem CID | 163896423 |
| Molecular Formula | C29H49O6- |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 493.35 |
| IUPAC Name | (E)-6,10-dihydroxy-16-(3-hydroxy-6-methoxy-4,5-dimethylcyclohexa-1,5-dien-1-yl)-2,6,10,14-tetramethylhexadec-2-enoate |
| SMILES | COC1=C(C)C(C)C(O)C=C1CCC(C)CCCC(C)(O)CCCC(C)(O)CC/C=C(\C)C(=O)[O-] |
| InChI | InChI=1S/C29H50O6/c1-20(13-14-24-19-25(30)22(3)23(4)26(24)35-7)11-8-15-28(5,33)17-10-18-29(6,34)16-9-12-21(2)27(31)32/h12,19-20,22,25,30,33-34H,8-11,13-18H2,1-7H3,(H,31,32)/p-1/b21-12+ |
| InChIKey | QGAKVIAIYZYLDC-CIAFOILYSA-M |
| XLogP | 4.58 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|