C29H47O3- — CID 143728384
(E)-10-hydroxy-2,6,10,14-tetramethyl-16-(2,3,4-trimethylphenyl)hexadec-5-enoate (PubChem CID 143728384) has the molecular formula C29H47O3- and a molecular weight of 443.69 g/mol. Its IUPAC name is (E)-10-hydroxy-2,6,10,14-tetramethyl-16-(2,3,4-trimethylphenyl)hexadec-5-enoate.
| Compound Name | (E)-10-hydroxy-2,6,10,14-tetramethyl-16-(2,3,4-trimethylphenyl)hexadec-5-enoate |
|---|---|
| PubChem CID | 143728384 |
| Molecular Formula | C29H47O3- |
| Molecular Weight | 443.69 g/mol |
| Exact Mass | 443.35 |
| IUPAC Name | (E)-10-hydroxy-2,6,10,14-tetramethyl-16-(2,3,4-trimethylphenyl)hexadec-5-enoate |
| SMILES | C/C(=C\CCC(C)C(=O)[O-])CCCC(C)(O)CCCC(C)CCc1ccc(C)c(C)c1C |
| InChI | InChI=1S/C29H48O3/c1-21(11-8-14-24(4)28(30)31)12-9-19-29(7,32)20-10-13-22(2)15-17-27-18-16-23(3)25(5)26(27)6/h11,16,18,22,24,32H,8-10,12-15,17,19-20H2,1-7H3,(H,30,31)/p-1/b21-11+ |
| InChIKey | FWTMJTSXWBEHIU-SRZZPIQSSA-M |
| XLogP | 6.38 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.69 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|