C27H47P — CID 129151737
[2,3-dimethyl-6-[(E)-3,7,11-trimethylhexadec-11-enyl]phenyl]phosphane (PubChem CID 129151737) has the molecular formula C27H47P and a molecular weight of 402.65 g/mol. Its IUPAC name is [2,3-dimethyl-6-[(E)-3,7,11-trimethylhexadec-11-enyl]phenyl]phosphane.
| Compound Name | [2,3-dimethyl-6-[(E)-3,7,11-trimethylhexadec-11-enyl]phenyl]phosphane |
|---|---|
| PubChem CID | 129151737 |
| Molecular Formula | C27H47P |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.34 |
| IUPAC Name | [2,3-dimethyl-6-[(E)-3,7,11-trimethylhexadec-11-enyl]phenyl]phosphane |
| SMILES | CCCC/C=C(\C)CCCC(C)CCCC(C)CCc1ccc(C)c(C)c1P |
| InChI | InChI=1S/C27H47P/c1-7-8-9-12-21(2)13-10-14-22(3)15-11-16-23(4)17-19-26-20-18-24(5)25(6)27(26)28/h12,18,20,22-23H,7-11,13-17,19,28H2,1-6H3/b21-12+ |
| InChIKey | JGROAXDQHICYRK-CIAFOILYSA-N |
| XLogP | 8.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|