C29H52O — CID 59271493
2-ethoxy-1,6-dimethyl-3-[(E)-3,7,11-trimethylhexadec-11-enyl]cyclohexa-1,3-diene (PubChem CID 59271493) has the molecular formula C29H52O and a molecular weight of 416.73 g/mol. Its IUPAC name is 2-ethoxy-1,6-dimethyl-3-[(E)-3,7,11-trimethylhexadec-11-enyl]cyclohexa-1,3-diene.
| Compound Name | 2-ethoxy-1,6-dimethyl-3-[(E)-3,7,11-trimethylhexadec-11-enyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 59271493 |
| Molecular Formula | C29H52O |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 416.40 |
| IUPAC Name | 2-ethoxy-1,6-dimethyl-3-[(E)-3,7,11-trimethylhexadec-11-enyl]cyclohexa-1,3-diene |
| SMILES | CCCC/C=C(\C)CCCC(C)CCCC(C)CCC1=CCC(C)C(C)=C1OCC |
| InChI | InChI=1S/C29H52O/c1-8-10-11-14-23(3)15-12-16-24(4)17-13-18-25(5)19-21-28-22-20-26(6)27(7)29(28)30-9-2/h14,22,24-26H,8-13,15-21H2,1-7H3/b23-14+ |
| InChIKey | GTRMFOLIZUHSPX-OEAKJJBVSA-N |
| XLogP | 9.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|