C35H64 — CID 162876231
(4R)-1-methyl-4-[(5Z,10S,14S,18S)-6,10,14,18,22-pentamethyltricosa-1,5-dien-2-yl]cyclohexene (PubChem CID 162876231) has the molecular formula C35H64 and a molecular weight of 484.90 g/mol. Its IUPAC name is (4R)-1-methyl-4-[(5Z,10S,14S,18S)-6,10,14,18,22-pentamethyltricosa-1,5-dien-2-yl]cyclohexene.
| Compound Name | (4R)-1-methyl-4-[(5Z,10S,14S,18S)-6,10,14,18,22-pentamethyltricosa-1,5-dien-2-yl]cyclohexene |
|---|---|
| PubChem CID | 162876231 |
| Molecular Formula | C35H64 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.50 |
| IUPAC Name | (4R)-1-methyl-4-[(5Z,10S,14S,18S)-6,10,14,18,22-pentamethyltricosa-1,5-dien-2-yl]cyclohexene |
| SMILES | C=C(CC/C=C(/C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@@H](C)CCCC(C)C)[C@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C35H64/c1-28(2)14-9-15-29(3)16-10-17-30(4)18-11-19-31(5)20-12-21-32(6)22-13-23-34(8)35-26-24-33(7)25-27-35/h22,24,28-31,35H,8-21,23,25-27H2,1-7H3/b32-22-/t29-,30-,31-,35-/m0/s1 |
| InChIKey | HYJZKCOWAKHVCB-MPVNVHFZSA-N |
| XLogP | 12.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|