C35H62O3 — CID 70895499
3-[(11E,14Z)-7-hydroxy-3,7,11-trimethylhexadeca-11,14-dienyl]-5,6-dimethyl-4-octoxycyclohexa-2,4-dien-1-ol (PubChem CID 70895499) has the molecular formula C35H62O3 and a molecular weight of 530.88 g/mol. Its IUPAC name is 3-[(11E,14Z)-7-hydroxy-3,7,11-trimethylhexadeca-11,14-dienyl]-5,6-dimethyl-4-octoxycyclohexa-2,4-dien-1-ol.
| Compound Name | 3-[(11E,14Z)-7-hydroxy-3,7,11-trimethylhexadeca-11,14-dienyl]-5,6-dimethyl-4-octoxycyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 70895499 |
| Molecular Formula | C35H62O3 |
| Molecular Weight | 530.88 g/mol |
| Exact Mass | 530.47 |
| IUPAC Name | 3-[(11E,14Z)-7-hydroxy-3,7,11-trimethylhexadeca-11,14-dienyl]-5,6-dimethyl-4-octoxycyclohexa-2,4-dien-1-ol |
| SMILES | C/C=C\C/C=C(\C)CCCC(C)(O)CCCC(C)CCC1=CC(O)C(C)C(C)=C1OCCCCCCCC |
| InChI | InChI=1S/C35H62O3/c1-8-10-12-13-14-16-26-38-34-31(6)30(5)33(36)27-32(34)23-22-29(4)21-18-25-35(7,37)24-17-20-28(3)19-15-11-9-2/h9,11,19,27,29-30,33,36-37H,8,10,12-18,20-26H2,1-7H3/b11-9-,28-19+ |
| InChIKey | AZAGEBFSJFBBAD-IEWJAFLWSA-N |
| XLogP | 9.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.88 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|