C36H70O4 — CID 158402455
16-(3-hydroxy-4,5-dimethyl-6-octoxycyclohexa-1,5-dien-1-yl)-6,10,14-trimethylhexadecane-6,10-diol;methane (PubChem CID 158402455) has the molecular formula C36H70O4 and a molecular weight of 566.95 g/mol. Its IUPAC name is 16-(3-hydroxy-4,5-dimethyl-6-octoxycyclohexa-1,5-dien-1-yl)-6,10,14-trimethylhexadecane-6,10-diol;methane.
| Compound Name | 16-(3-hydroxy-4,5-dimethyl-6-octoxycyclohexa-1,5-dien-1-yl)-6,10,14-trimethylhexadecane-6,10-diol;methane |
|---|---|
| PubChem CID | 158402455 |
| Molecular Formula | C36H70O4 |
| Molecular Weight | 566.95 g/mol |
| Exact Mass | 566.53 |
| IUPAC Name | 16-(3-hydroxy-4,5-dimethyl-6-octoxycyclohexa-1,5-dien-1-yl)-6,10,14-trimethylhexadecane-6,10-diol;methane |
| SMILES | C.CCCCCCCCOC1=C(C)C(C)C(O)C=C1CCC(C)CCCC(C)(O)CCCC(C)(O)CCCCC |
| InChI | InChI=1S/C35H66O4.CH4/c1-8-10-12-13-14-16-26-39-33-30(5)29(4)32(36)27-31(33)21-20-28(3)19-17-23-35(7,38)25-18-24-34(6,37)22-15-11-9-2;/h27-29,32,36-38H,8-26H2,1-7H3;1H4 |
| InChIKey | GYGRJSFAKNQSAW-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.95 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|