C17H34O2 — CID 129151722
(E)-6,10-dimethylpentadec-10-ene-2,6-diol (PubChem CID 129151722) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is (E)-6,10-dimethylpentadec-10-ene-2,6-diol.
| Compound Name | (E)-6,10-dimethylpentadec-10-ene-2,6-diol |
|---|---|
| PubChem CID | 129151722 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | (E)-6,10-dimethylpentadec-10-ene-2,6-diol |
| SMILES | CCCC/C=C(\C)CCCC(C)(O)CCCC(C)O |
| InChI | InChI=1S/C17H34O2/c1-5-6-7-10-15(2)11-8-13-17(4,19)14-9-12-16(3)18/h10,16,18-19H,5-9,11-14H2,1-4H3/b15-10+ |
| InChIKey | JKOUZSXOGHHUIX-XNTDXEJSSA-N |
| XLogP | 4.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|