C19H36O — CID 72571502
3,7,11-trimethylhexadeca-6,10-dien-3-ol (PubChem CID 72571502) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is 3,7,11-trimethylhexadeca-6,10-dien-3-ol.
| Compound Name | 3,7,11-trimethylhexadeca-6,10-dien-3-ol |
|---|---|
| PubChem CID | 72571502 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | 3,7,11-trimethylhexadeca-6,10-dien-3-ol |
| SMILES | CCCCCC(C)=CCCC(C)=CCCC(C)(O)CC |
| InChI | InChI=1S/C19H36O/c1-6-8-9-12-17(3)13-10-14-18(4)15-11-16-19(5,20)7-2/h13,15,20H,6-12,14,16H2,1-5H3 |
| InChIKey | OTWCIUYMRHZWEY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|