C29H48 — CID 123795162
1-[5-butyl-2-methyl-4-(2-methylbutyl)deca-3,5-dien-3-yl]-2,3,4-trimethylbenzene (PubChem CID 123795162) has the molecular formula C29H48 and a molecular weight of 396.70 g/mol. Its IUPAC name is 1-[5-butyl-2-methyl-4-(2-methylbutyl)deca-3,5-dien-3-yl]-2,3,4-trimethylbenzene.
| Compound Name | 1-[5-butyl-2-methyl-4-(2-methylbutyl)deca-3,5-dien-3-yl]-2,3,4-trimethylbenzene |
|---|---|
| PubChem CID | 123795162 |
| Molecular Formula | C29H48 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.38 |
| IUPAC Name | 1-[5-butyl-2-methyl-4-(2-methylbutyl)deca-3,5-dien-3-yl]-2,3,4-trimethylbenzene |
| SMILES | CCCCC=C(CCCC)C(CC(C)CC)=C(c1ccc(C)c(C)c1C)C(C)C |
| InChI | InChI=1S/C29H48/c1-10-13-15-17-26(16-14-11-2)28(20-22(6)12-3)29(21(4)5)27-19-18-23(7)24(8)25(27)9/h17-19,21-22H,10-16,20H2,1-9H3 |
| InChIKey | AJMCPMIHLBFLMD-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|