C23H38O2 — CID 141279975
2-hexyl-2-hydroxy-1-(2,3,4-trimethylphenyl)octan-1-one (PubChem CID 141279975) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 2-hexyl-2-hydroxy-1-(2,3,4-trimethylphenyl)octan-1-one.
| Compound Name | 2-hexyl-2-hydroxy-1-(2,3,4-trimethylphenyl)octan-1-one |
|---|---|
| PubChem CID | 141279975 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 2-hexyl-2-hydroxy-1-(2,3,4-trimethylphenyl)octan-1-one |
| SMILES | CCCCCCC(O)(CCCCCC)C(=O)c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C23H38O2/c1-6-8-10-12-16-23(25,17-13-11-9-7-2)22(24)21-15-14-18(3)19(4)20(21)5/h14-15,25H,6-13,16-17H2,1-5H3 |
| InChIKey | FRSJLHRVXJAKLG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|