2-heptyl-4-methylbenzene-1,3-dicarboxylic acid

C16H22O4 — CID 151074604

IUPAC2-heptyl-4-methylbenzene-1,3-dicarboxylic acid
SMILESCCCCCCCc1c(C(=O)O)ccc(C)c1C(=O)O
InChIInChI=1S/C16H22O4/c1-3-4-5-6-7-8-12-13(15(17)18)10-9-11(2)14(12)16(19)20/h9-10H,3-8H2,1-2H3,(H,17,18)(H,19,20)
InChIKeyMIVSLOATXYHCKK-UHFFFAOYSA-N
MW278.35 g/mol
LogP3.90
Rot. Bonds8

About 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid

2-heptyl-4-methylbenzene-1,3-dicarboxylic acid (PubChem CID 151074604) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name2-heptyl-4-methylbenzene-1,3-dicarboxylic acid
PubChem CID151074604
Molecular FormulaC16H22O4
Molecular Weight278.35 g/mol
Exact Mass278.15
IUPAC Name2-heptyl-4-methylbenzene-1,3-dicarboxylic acid
SMILESCCCCCCCc1c(C(=O)O)ccc(C)c1C(=O)O
InChIInChI=1S/C16H22O4/c1-3-4-5-6-7-8-12-13(15(17)18)10-9-11(2)14(12)16(19)20/h9-10H,3-8H2,1-2H3,(H,17,18)(H,19,20)
InChIKeyMIVSLOATXYHCKK-UHFFFAOYSA-N
XLogP3.90
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 53.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid (CID 151074604) is 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid is CCCCCCCc1c(C(=O)O)ccc(C)c1C(=O)O.
What is the InChIKey of 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is MIVSLOATXYHCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4/c1-3-4-5-6-7-8-12-13(15(17)18)10-9-11(2)14(12)16(19)20/h9-10H,3-8H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid?
2-heptyl-4-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 278.35 g/mol, XLogP of 3.90, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-4-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 151074604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).