C12H16O — CID 19901190
1-(2,3,4-trimethylphenyl)propan-1-one (PubChem CID 19901190) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-(2,3,4-trimethylphenyl)propan-1-one.
| Compound Name | 1-(2,3,4-trimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 19901190 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 1-(2,3,4-trimethylphenyl)propan-1-one |
| SMILES | CCC(=O)c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C12H16O/c1-5-12(13)11-7-6-8(2)9(3)10(11)4/h6-7H,5H2,1-4H3 |
| InChIKey | MHGXHYGSTAKAOI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |