C10H11ClO2 — CID 82266490
2-chloro-1-(4-hydroxy-2,3-dimethylphenyl)ethanone (PubChem CID 82266490) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is 2-chloro-1-(4-hydroxy-2,3-dimethylphenyl)ethanone.
| Compound Name | 2-chloro-1-(4-hydroxy-2,3-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 82266490 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 2-chloro-1-(4-hydroxy-2,3-dimethylphenyl)ethanone |
| SMILES | Cc1c(O)ccc(C(=O)CCl)c1C |
| InChI | InChI=1S/C10H11ClO2/c1-6-7(2)9(12)4-3-8(6)10(13)5-11/h3-4,12H,5H2,1-2H3 |
| InChIKey | BITZXDPVCANSQJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|