C10H14ClNO — CID 67157686
2,3,4-trimethylbenzamide;hydrochloride (PubChem CID 67157686) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 2,3,4-trimethylbenzamide;hydrochloride.
| Compound Name | 2,3,4-trimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 67157686 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2,3,4-trimethylbenzamide;hydrochloride |
| SMILES | Cc1ccc(C(N)=O)c(C)c1C.Cl |
| InChI | InChI=1S/C10H13NO.ClH/c1-6-4-5-9(10(11)12)8(3)7(6)2;/h4-5H,1-3H3,(H2,11,12);1H |
| InChIKey | JJEIBLBZNCKIMZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |