C18H20O — CID 70628642
(2,4-dimethylphenyl)-(2,3,4-trimethylphenyl)methanone (PubChem CID 70628642) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-(2,3,4-trimethylphenyl)methanone.
| Compound Name | (2,4-dimethylphenyl)-(2,3,4-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 70628642 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (2,4-dimethylphenyl)-(2,3,4-trimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccc(C)c(C)c2C)c(C)c1 |
| InChI | InChI=1S/C18H20O/c1-11-6-8-16(13(3)10-11)18(19)17-9-7-12(2)14(4)15(17)5/h6-10H,1-5H3 |
| InChIKey | KMIZQYLFUUITKS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |