C24H21O3P — CID 140523804
[3-(2,4-dimethylbenzoyl)-4-phosphorosophenyl]-(2,4-dimethylphenyl)methanone (PubChem CID 140523804) has the molecular formula C24H21O3P and a molecular weight of 388.40 g/mol. Its IUPAC name is [3-(2,4-dimethylbenzoyl)-4-phosphorosophenyl]-(2,4-dimethylphenyl)methanone.
| Compound Name | [3-(2,4-dimethylbenzoyl)-4-phosphorosophenyl]-(2,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 140523804 |
| Molecular Formula | C24H21O3P |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [3-(2,4-dimethylbenzoyl)-4-phosphorosophenyl]-(2,4-dimethylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccc(P=O)c(C(=O)c3ccc(C)cc3C)c2)c(C)c1 |
| InChI | InChI=1S/C24H21O3P/c1-14-5-8-19(16(3)11-14)23(25)18-7-10-22(28-27)21(13-18)24(26)20-9-6-15(2)12-17(20)4/h5-13H,1-4H3 |
| InChIKey | NOQVGTOTWNUYFY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|