C10H10NO3- — CID 22769833
2-carbamoyl-3,4-dimethylbenzoate (PubChem CID 22769833) has the molecular formula C10H10NO3- and a molecular weight of 192.19 g/mol. Its IUPAC name is 2-carbamoyl-3,4-dimethylbenzoate.
| Compound Name | 2-carbamoyl-3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 22769833 |
| Molecular Formula | C10H10NO3- |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-carbamoyl-3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])c(C(N)=O)c1C |
| InChI | InChI=1S/C10H11NO3/c1-5-3-4-7(10(13)14)8(6(5)2)9(11)12/h3-4H,1-2H3,(H2,11,12)(H,13,14)/p-1 |
| InChIKey | QKYJEMIMXUCCCJ-UHFFFAOYSA-M |
| XLogP | -0.23 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |