C14H12O4-2 — CID 22222062
2,3-bis(prop-1-en-2-yl)terephthalate (PubChem CID 22222062) has the molecular formula C14H12O4-2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2,3-bis(prop-1-en-2-yl)terephthalate.
| Compound Name | 2,3-bis(prop-1-en-2-yl)terephthalate |
|---|---|
| PubChem CID | 22222062 |
| Molecular Formula | C14H12O4-2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2,3-bis(prop-1-en-2-yl)terephthalate |
| SMILES | C=C(C)c1c(C(=O)[O-])ccc(C(=O)[O-])c1C(=C)C |
| InChI | InChI=1S/C14H14O4/c1-7(2)11-9(13(15)16)5-6-10(14(17)18)12(11)8(3)4/h5-6H,1,3H2,2,4H3,(H,15,16)(H,17,18)/p-2 |
| InChIKey | FZWNLEDZGIIYHE-UHFFFAOYSA-L |
| XLogP | 0.48 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |