C15H18O — CID 101292776
2,3,6-tris(prop-1-en-2-yl)phenol (PubChem CID 101292776) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 2,3,6-tris(prop-1-en-2-yl)phenol.
| Compound Name | 2,3,6-tris(prop-1-en-2-yl)phenol |
|---|---|
| PubChem CID | 101292776 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2,3,6-tris(prop-1-en-2-yl)phenol |
| SMILES | C=C(C)c1ccc(C(=C)C)c(C(=C)C)c1O |
| InChI | InChI=1S/C15H18O/c1-9(2)12-7-8-13(10(3)4)15(16)14(12)11(5)6/h7-8,16H,1,3,5H2,2,4,6H3 |
| InChIKey | NSSCVYDZGWHQQL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |