C17H18N2O2-2 — CID 23452776
1,2,3-tris(prop-1-en-2-yl)benzene diisocyanate (PubChem CID 23452776) has the molecular formula C17H18N2O2-2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1,2,3-tris(prop-1-en-2-yl)benzene diisocyanate.
| Compound Name | 1,2,3-tris(prop-1-en-2-yl)benzene diisocyanate |
|---|---|
| PubChem CID | 23452776 |
| Molecular Formula | C17H18N2O2-2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1,2,3-tris(prop-1-en-2-yl)benzene diisocyanate |
| SMILES | C=C(C)c1cccc(C(=C)C)c1C(=C)C.[N-]=C=O.[N-]=C=O |
| InChI | InChI=1S/C15H18.2CNO/c1-10(2)13-8-7-9-14(11(3)4)15(13)12(5)6;2*2-1-3/h7-9H,1,3,5H2,2,4,6H3;;/q;2*-1 |
| InChIKey | JBQXCJDRVACTIO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 78.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|