C15H20 — CID 141209236
2-propan-2-yl-1,3-bis(prop-1-en-2-yl)benzene (PubChem CID 141209236) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 2-propan-2-yl-1,3-bis(prop-1-en-2-yl)benzene.
| Compound Name | 2-propan-2-yl-1,3-bis(prop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 141209236 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-propan-2-yl-1,3-bis(prop-1-en-2-yl)benzene |
| SMILES | C=C(C)c1cccc(C(=C)C)c1C(C)C |
| InChI | InChI=1S/C15H20/c1-10(2)13-8-7-9-14(11(3)4)15(13)12(5)6/h7-9,12H,1,3H2,2,4-6H3 |
| InChIKey | UWOQYUJMJBJVJE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |