C10H18N4O8 — CID 69282657
tetraazanium;benzene-1,2,3,4-tetracarboxylate (PubChem CID 69282657) has the molecular formula C10H18N4O8 and a molecular weight of 322.27 g/mol. Its IUPAC name is tetraazanium;benzene-1,2,3,4-tetracarboxylate.
| Compound Name | tetraazanium;benzene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 69282657 |
| Molecular Formula | C10H18N4O8 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | tetraazanium;benzene-1,2,3,4-tetracarboxylate |
| SMILES | O=C([O-])c1ccc(C(=O)[O-])c(C(=O)[O-])c1C(=O)[O-].[NH4+].[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/C10H6O8.4H3N/c11-7(12)3-1-2-4(8(13)14)6(10(17)18)5(3)9(15)16;;;;/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);4*1H3 |
| InChIKey | KOOLMABFSWIFCR-UHFFFAOYSA-N |
| XLogP | -3.35 |
| TPSA | 306.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |