C34H66N4O16 — CID 67441557
benzene-1,2,3,4-tetracarboxylate;tetrakis(bis(2-methoxyethyl)azanium) (PubChem CID 67441557) has the molecular formula C34H66N4O16 and a molecular weight of 786.91 g/mol. Its IUPAC name is benzene-1,2,3,4-tetracarboxylate;tetrakis(bis(2-methoxyethyl)azanium).
| Compound Name | benzene-1,2,3,4-tetracarboxylate;tetrakis(bis(2-methoxyethyl)azanium) |
|---|---|
| PubChem CID | 67441557 |
| Molecular Formula | C34H66N4O16 |
| Molecular Weight | 786.91 g/mol |
| Exact Mass | 786.45 |
| IUPAC Name | benzene-1,2,3,4-tetracarboxylate;tetrakis(bis(2-methoxyethyl)azanium) |
| SMILES | COCC[NH2+]CCOC.COCC[NH2+]CCOC.COCC[NH2+]CCOC.COCC[NH2+]CCOC.O=C([O-])c1ccc(C(=O)[O-])c(C(=O)[O-])c1C(=O)[O-] |
| InChI | InChI=1S/C10H6O8.4C6H15NO2/c11-7(12)3-1-2-4(8(13)14)6(10(17)18)5(3)9(15)16;4*1-8-5-3-7-4-6-9-2/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);4*7H,3-6H2,1-2H3 |
| InChIKey | XCAZVMVYMINTTA-UHFFFAOYSA-N |
| XLogP | -9.49 |
| TPSA | 300.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.91 |
| LogP ≤ 5 | -9.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|