About bis(2-methoxyethyl)azanium;2-hydroxyacetate
bis(2-methoxyethyl)azanium;2-hydroxyacetate (PubChem CID 87300456) has the molecular formula C8H19NO5
and a molecular weight of 209.24 g/mol. Its IUPAC name is bis(2-methoxyethyl)azanium;2-hydroxyacetate.
Molecular Properties
| Compound Name | bis(2-methoxyethyl)azanium;2-hydroxyacetate |
| PubChem CID | 87300456 |
| Molecular Formula | C8H19NO5 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | bis(2-methoxyethyl)azanium;2-hydroxyacetate |
| SMILES | COCC[NH2+]CCOC.O=C([O-])CO |
| InChI | InChI=1S/C6H15NO2.C2H4O3/c1-8-5-3-7-4-6-9-2;3-1-2(4)5/h7H,3-6H2,1-2H3;3H,1H2,(H,4,5) |
| InChIKey | KANXNNWQBIDKKP-UHFFFAOYSA-N |
| XLogP | -3.43 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methoxyethyl)azanium;2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methoxyethyl)azanium;2-hydroxyacetate?
The IUPAC name of bis(2-methoxyethyl)azanium;2-hydroxyacetate (CID 87300456) is bis(2-methoxyethyl)azanium;2-hydroxyacetate.
What is the SMILES notation for bis(2-methoxyethyl)azanium;2-hydroxyacetate?
The canonical SMILES for bis(2-methoxyethyl)azanium;2-hydroxyacetate is COCC[NH2+]CCOC.O=C([O-])CO.
What is the InChIKey of bis(2-methoxyethyl)azanium;2-hydroxyacetate?
The InChIKey is KANXNNWQBIDKKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2.C2H4O3/c1-8-5-3-7-4-6-9-2;3-1-2(4)5/h7H,3-6H2,1-2H3;3H,1H2,(H,4,5).
What are the key properties of bis(2-methoxyethyl)azanium;2-hydroxyacetate?
bis(2-methoxyethyl)azanium;2-hydroxyacetate has a molecular weight of 209.24 g/mol, XLogP of -3.43, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methoxyethyl)azanium;2-hydroxyacetate is sourced from PubChem (CID 87300456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).